C8H11ClN4O2S — CID 116798744
N-(2-chloropyrimidin-4-yl)pyrrolidine-1-sulfonamide (PubChem CID 116798744) has the molecular formula C8H11ClN4O2S and a molecular weight of 262.72 g/mol. Its IUPAC name is N-(2-chloropyrimidin-4-yl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(2-chloropyrimidin-4-yl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 116798744 |
| Molecular Formula | C8H11ClN4O2S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | N-(2-chloropyrimidin-4-yl)pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(Nc1ccnc(Cl)n1)N1CCCC1 |
| InChI | InChI=1S/C8H11ClN4O2S/c9-8-10-4-3-7(11-8)12-16(14,15)13-5-1-2-6-13/h3-4H,1-2,5-6H2,(H,10,11,12) |
| InChIKey | UCYAPVHBRSFGSR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |