C7H7ClF3N3O2S — CID 103094565
3-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyridin-2-amine (PubChem CID 103094565) has the molecular formula C7H7ClF3N3O2S and a molecular weight of 289.67 g/mol. Its IUPAC name is 3-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103094565 |
| Molecular Formula | C7H7ClF3N3O2S |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyridin-2-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)Nc1ncccc1Cl |
| InChI | InChI=1S/C7H7ClF3N3O2S/c8-5-2-1-3-12-6(5)14-17(15,16)13-4-7(9,10)11/h1-3,13H,4H2,(H,12,14) |
| InChIKey | FZXZHSWSFIJWKP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |