C7H9ClN4O3S — CID 114959569
4-chloro-N'-hydroxy-2-(sulfamoylamino)benzenecarboximidamide (PubChem CID 114959569) has the molecular formula C7H9ClN4O3S and a molecular weight of 264.69 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-(sulfamoylamino)benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-(sulfamoylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 114959569 |
| Molecular Formula | C7H9ClN4O3S |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-(sulfamoylamino)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(Cl)cc1NS(N)(=O)=O |
| InChI | InChI=1S/C7H9ClN4O3S/c8-4-1-2-5(7(9)11-13)6(3-4)12-16(10,14)15/h1-3,12-13H,(H2,9,11)(H2,10,14,15) |
| InChIKey | UOBWZRMTORRTBY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|