C9H7ClN2O4S — CID 43361980
2-[(4-chloro-3-cyanophenyl)sulfamoyl]acetic acid (PubChem CID 43361980) has the molecular formula C9H7ClN2O4S and a molecular weight of 274.69 g/mol. Its IUPAC name is 2-[(4-chloro-3-cyanophenyl)sulfamoyl]acetic acid.
| Compound Name | 2-[(4-chloro-3-cyanophenyl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43361980 |
| Molecular Formula | C9H7ClN2O4S |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-[(4-chloro-3-cyanophenyl)sulfamoyl]acetic acid |
| SMILES | N#Cc1cc(NS(=O)(=O)CC(=O)O)ccc1Cl |
| InChI | InChI=1S/C9H7ClN2O4S/c10-8-2-1-7(3-6(8)4-11)12-17(15,16)5-9(13)14/h1-3,12H,5H2,(H,13,14) |
| InChIKey | HSCKGODWFVBXAA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |