C11H12Cl2N2O2S — CID 79585540
3-chloro-N-(4-chloro-3-cyanophenyl)-2-methylpropane-1-sulfonamide (PubChem CID 79585540) has the molecular formula C11H12Cl2N2O2S and a molecular weight of 307.20 g/mol. Its IUPAC name is 3-chloro-N-(4-chloro-3-cyanophenyl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(4-chloro-3-cyanophenyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79585540 |
| Molecular Formula | C11H12Cl2N2O2S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-chloro-N-(4-chloro-3-cyanophenyl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1ccc(Cl)c(C#N)c1 |
| InChI | InChI=1S/C11H12Cl2N2O2S/c1-8(5-12)7-18(16,17)15-10-2-3-11(13)9(4-10)6-14/h2-4,8,15H,5,7H2,1H3 |
| InChIKey | UJQNPWJUUHPWCA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|