C13H19Cl2NO3S — CID 79585676
3-chloro-N-(3-chloro-4-propan-2-yloxyphenyl)-2-methylpropane-1-sulfonamide (PubChem CID 79585676) has the molecular formula C13H19Cl2NO3S and a molecular weight of 340.27 g/mol. Its IUPAC name is 3-chloro-N-(3-chloro-4-propan-2-yloxyphenyl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(3-chloro-4-propan-2-yloxyphenyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79585676 |
| Molecular Formula | C13H19Cl2NO3S |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-chloro-N-(3-chloro-4-propan-2-yloxyphenyl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NO3S/c1-9(2)19-13-5-4-11(6-12(13)15)16-20(17,18)8-10(3)7-14/h4-6,9-10,16H,7-8H2,1-3H3 |
| InChIKey | CCYSSJSBXYEOEN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|