C11H13ClF3NO3S — CID 79580115
3-chloro-2-methyl-N-[4-(trifluoromethoxy)phenyl]propane-1-sulfonamide (PubChem CID 79580115) has the molecular formula C11H13ClF3NO3S and a molecular weight of 331.74 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[4-(trifluoromethoxy)phenyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[4-(trifluoromethoxy)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79580115 |
| Molecular Formula | C11H13ClF3NO3S |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 3-chloro-2-methyl-N-[4-(trifluoromethoxy)phenyl]propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13ClF3NO3S/c1-8(6-12)7-20(17,18)16-9-2-4-10(5-3-9)19-11(13,14)15/h2-5,8,16H,6-7H2,1H3 |
| InChIKey | JLELVOZKBCUNEH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|