C15H24ClNO2S — CID 79585956
3-chloro-2-methyl-N-(4-pentylphenyl)propane-1-sulfonamide (PubChem CID 79585956) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(4-pentylphenyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-(4-pentylphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 79585956 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-chloro-2-methyl-N-(4-pentylphenyl)propane-1-sulfonamide |
| SMILES | CCCCCc1ccc(NS(=O)(=O)CC(C)CCl)cc1 |
| InChI | InChI=1S/C15H24ClNO2S/c1-3-4-5-6-14-7-9-15(10-8-14)17-20(18,19)12-13(2)11-16/h7-10,13,17H,3-6,11-12H2,1-2H3 |
| InChIKey | QZGCPNCMACEFTF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|