C11H11Cl2NO2S — CID 66105567
2-chloro-4-(3-chloro-2-methylpropyl)sulfonylbenzonitrile (PubChem CID 66105567) has the molecular formula C11H11Cl2NO2S and a molecular weight of 292.19 g/mol. Its IUPAC name is 2-chloro-4-(3-chloro-2-methylpropyl)sulfonylbenzonitrile.
| Compound Name | 2-chloro-4-(3-chloro-2-methylpropyl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 66105567 |
| Molecular Formula | C11H11Cl2NO2S |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-chloro-4-(3-chloro-2-methylpropyl)sulfonylbenzonitrile |
| SMILES | CC(CCl)CS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO2S/c1-8(5-12)7-17(15,16)10-3-2-9(6-14)11(13)4-10/h2-4,8H,5,7H2,1H3 |
| InChIKey | VZIPFCRHVZSOEC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|