C12H16N2O3S — CID 106954583
1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)propane-1-sulfonamide (PubChem CID 106954583) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)propane-1-sulfonamide.
| Compound Name | 1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106954583 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)propane-1-sulfonamide |
| SMILES | CCC(C#N)S(=O)(=O)Nc1cc(C)c(O)cc1C |
| InChI | InChI=1S/C12H16N2O3S/c1-4-10(7-13)18(16,17)14-11-5-9(3)12(15)6-8(11)2/h5-6,10,14-15H,4H2,1-3H3 |
| InChIKey | OIUDIMUIZJRGLJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|