C12H17NO5S — CID 106954607
methyl 2-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]propanoate (PubChem CID 106954607) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 2-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]propanoate.
| Compound Name | methyl 2-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 106954607 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 2-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)Nc1cc(C)c(O)cc1C |
| InChI | InChI=1S/C12H17NO5S/c1-7-6-11(14)8(2)5-10(7)13-19(16,17)9(3)12(15)18-4/h5-6,9,13-14H,1-4H3 |
| InChIKey | PHZSHHMTVAHJPX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|