C19H18Cl3N3O3S2 — CID 87902969
2,5-dichloro-N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]thiophene-3-sulfonamide;hydrochloride (PubChem CID 87902969) has the molecular formula C19H18Cl3N3O3S2 and a molecular weight of 506.86 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]thiophene-3-sulfonamide;hydrochloride.
| Compound Name | 2,5-dichloro-N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]thiophene-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 87902969 |
| Molecular Formula | C19H18Cl3N3O3S2 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | 2,5-dichloro-N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]thiophene-3-sulfonamide;hydrochloride |
| SMILES | Cl.N/N=C\c1ccc(CCOc2cccc(NS(=O)(=O)c3cc(Cl)sc3Cl)c2)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O3S2.ClH/c20-18-11-17(19(21)28-18)29(25,26)24-15-2-1-3-16(10-15)27-9-8-13-4-6-14(7-5-13)12-23-22;/h1-7,10-12,24H,8-9,22H2;1H/b23-12-; |
| InChIKey | MMFPYKBYTLGZPU-DYHCZZJSSA-N |
| XLogP | 5.19 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|