C16H17F3N2O4S — CID 170347385
2-ethoxy-4-(methylamino)-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 170347385) has the molecular formula C16H17F3N2O4S and a molecular weight of 390.38 g/mol. Its IUPAC name is 2-ethoxy-4-(methylamino)-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2-ethoxy-4-(methylamino)-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 170347385 |
| Molecular Formula | C16H17F3N2O4S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-ethoxy-4-(methylamino)-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | CCOc1cc(NC)ccc1S(=O)(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2O4S/c1-3-24-14-10-11(20-2)7-8-15(14)26(22,23)21-12-5-4-6-13(9-12)25-16(17,18)19/h4-10,20-21H,3H2,1-2H3 |
| InChIKey | CXWYGJMAYSNBAN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |