C15H13F3N2O6S — CID 169204758
2-ethoxy-4-nitro-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 169204758) has the molecular formula C15H13F3N2O6S and a molecular weight of 406.34 g/mol. Its IUPAC name is 2-ethoxy-4-nitro-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2-ethoxy-4-nitro-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 169204758 |
| Molecular Formula | C15H13F3N2O6S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-ethoxy-4-nitro-N-[3-(trifluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | CCOc1cc([N+](=O)[O-])ccc1S(=O)(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N2O6S/c1-2-25-13-9-11(20(21)22)6-7-14(13)27(23,24)19-10-4-3-5-12(8-10)26-15(16,17)18/h3-9,19H,2H2,1H3 |
| InChIKey | UMKLOPMUBZVIMI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|