C18H15F3N2O4S — CID 5186150
8-ethoxy-N-[3-(trifluoromethoxy)phenyl]quinoline-5-sulfonamide (PubChem CID 5186150) has the molecular formula C18H15F3N2O4S and a molecular weight of 412.39 g/mol. Its IUPAC name is 8-ethoxy-N-[3-(trifluoromethoxy)phenyl]quinoline-5-sulfonamide.
| Compound Name | 8-ethoxy-N-[3-(trifluoromethoxy)phenyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 5186150 |
| Molecular Formula | C18H15F3N2O4S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 8-ethoxy-N-[3-(trifluoromethoxy)phenyl]quinoline-5-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(OC(F)(F)F)c2)c2cccnc12 |
| InChI | InChI=1S/C18H15F3N2O4S/c1-2-26-15-8-9-16(14-7-4-10-22-17(14)15)28(24,25)23-12-5-3-6-13(11-12)27-18(19,20)21/h3-11,23H,2H2,1H3 |
| InChIKey | DQLVJMXOYYHXSQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |