C26H29ClN4O4S — CID 54435739
3-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]butanamide (PubChem CID 54435739) has the molecular formula C26H29ClN4O4S and a molecular weight of 529.06 g/mol. Its IUPAC name is 3-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]butanamide.
| Compound Name | 3-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]butanamide |
|---|---|
| PubChem CID | 54435739 |
| Molecular Formula | C26H29ClN4O4S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 3-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]butanamide |
| SMILES | [H]/N=C(\N)c1ccc(CCOc2cccc(N(CS(=O)(=O)c3ccccc3Cl)C(C)CC(N)=O)c2)cc1 |
| InChI | InChI=1S/C26H29ClN4O4S/c1-18(15-25(28)32)31(17-36(33,34)24-8-3-2-7-23(24)27)21-5-4-6-22(16-21)35-14-13-19-9-11-20(12-10-19)26(29)30/h2-12,16,18H,13-15,17H2,1H3,(H2,28,32)(H3,29,30) |
| InChIKey | WKPHJVJZXPRGEU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|