C24H25ClN4O4S — CID 54324120
2-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-methylanilino]-N-(2-chlorophenyl)sulfonylacetamide (PubChem CID 54324120) has the molecular formula C24H25ClN4O4S and a molecular weight of 501.01 g/mol. Its IUPAC name is 2-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-methylanilino]-N-(2-chlorophenyl)sulfonylacetamide.
| Compound Name | 2-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-methylanilino]-N-(2-chlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 54324120 |
| Molecular Formula | C24H25ClN4O4S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 2-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-methylanilino]-N-(2-chlorophenyl)sulfonylacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CCOc2cccc(N(C)CC(=O)NS(=O)(=O)c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C24H25ClN4O4S/c1-29(16-23(30)28-34(31,32)22-8-3-2-7-21(22)25)19-5-4-6-20(15-19)33-14-13-17-9-11-18(12-10-17)24(26)27/h2-12,15H,13-14,16H2,1H3,(H3,26,27)(H,28,30) |
| InChIKey | STSBTROSZFRWJM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|