C27H31ClN4O4S — CID 54331713
5-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]pentanamide (PubChem CID 54331713) has the molecular formula C27H31ClN4O4S and a molecular weight of 543.09 g/mol. Its IUPAC name is 5-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]pentanamide.
| Compound Name | 5-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]pentanamide |
|---|---|
| PubChem CID | 54331713 |
| Molecular Formula | C27H31ClN4O4S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 5-[3-[2-(4-carbamimidoylphenyl)ethoxy]-N-[(2-chlorophenyl)sulfonylmethyl]anilino]pentanamide |
| SMILES | [H]/N=C(\N)c1ccc(CCOc2cccc(N(CCCCC(N)=O)CS(=O)(=O)c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C27H31ClN4O4S/c28-24-8-1-2-9-25(24)37(34,35)19-32(16-4-3-10-26(29)33)22-6-5-7-23(18-22)36-17-15-20-11-13-21(14-12-20)27(30)31/h1-2,5-9,11-14,18H,3-4,10,15-17,19H2,(H2,29,33)(H3,30,31) |
| InChIKey | SYULVHZSLCHCAY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|