C21H27N5O2 — CID 21217968
methyl 4-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]butanoate (PubChem CID 21217968) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is methyl 4-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]butanoate.
| Compound Name | methyl 4-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]butanoate |
|---|---|
| PubChem CID | 21217968 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | methyl 4-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(CCN(CCCC(=O)OC)c2cccc(/C(N)=N/[H])c2)cc1 |
| InChI | InChI=1S/C21H27N5O2/c1-28-19(27)6-3-12-26(18-5-2-4-17(14-18)21(24)25)13-11-15-7-9-16(10-8-15)20(22)23/h2,4-5,7-10,14H,3,6,11-13H2,1H3,(H3,22,23)(H3,24,25) |
| InChIKey | KIOKGFXLFPBZEB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|