C11H13NO4 — CID 77013461
2-[(3-ethoxyphenyl)methylideneamino]oxyacetic acid (PubChem CID 77013461) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-[(3-ethoxyphenyl)methylideneamino]oxyacetic acid.
| Compound Name | 2-[(3-ethoxyphenyl)methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 77013461 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-[(3-ethoxyphenyl)methylideneamino]oxyacetic acid |
| SMILES | CCOc1cccc(C=NOCC(=O)O)c1 |
| InChI | InChI=1S/C11H13NO4/c1-2-15-10-5-3-4-9(6-10)7-12-16-8-11(13)14/h3-7H,2,8H2,1H3,(H,13,14) |
| InChIKey | RSVFAWRSHYRELI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|