C26H37N5O7S2 — CID 22722503
[3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-(4-pyrrolidin-1-ylpiperidin-1-yl)sulfonylbenzenesulfonate (PubChem CID 22722503) has the molecular formula C26H37N5O7S2 and a molecular weight of 595.74 g/mol. Its IUPAC name is [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-(4-pyrrolidin-1-ylpiperidin-1-yl)sulfonylbenzenesulfonate.
| Compound Name | [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-(4-pyrrolidin-1-ylpiperidin-1-yl)sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 22722503 |
| Molecular Formula | C26H37N5O7S2 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-(4-pyrrolidin-1-ylpiperidin-1-yl)sulfonylbenzenesulfonate |
| SMILES | Cc1cc(OCCCON=C(N)N)cc(OS(=O)(=O)c2ccccc2S(=O)(=O)N2CCC(N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C26H37N5O7S2/c1-20-17-22(36-15-6-16-37-29-26(27)28)19-23(18-20)38-40(34,35)25-8-3-2-7-24(25)39(32,33)31-13-9-21(10-14-31)30-11-4-5-12-30/h2-3,7-8,17-19,21H,4-6,9-16H2,1H3,(H4,27,28,29) |
| InChIKey | SFCBBANCKCADCW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 166.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|