C20H24N2O8S2 — CID 57239175
ethyl 4-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 57239175) has the molecular formula C20H24N2O8S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is ethyl 4-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 57239175 |
| Molecular Formula | C20H24N2O8S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | ethyl 4-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccccc2S(=O)(=O)Oc2cc(C)cc(O)c2)CC1 |
| InChI | InChI=1S/C20H24N2O8S2/c1-3-29-20(24)21-8-10-22(11-9-21)31(25,26)18-6-4-5-7-19(18)32(27,28)30-17-13-15(2)12-16(23)14-17/h4-7,12-14,23H,3,8-11H2,1-2H3 |
| InChIKey | QPAZIUNNCLRECF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|