C14H14O6S2 — CID 57307806
(3-hydroxy-5-methylphenyl) 3-methylsulfonylbenzenesulfonate (PubChem CID 57307806) has the molecular formula C14H14O6S2 and a molecular weight of 342.39 g/mol. Its IUPAC name is (3-hydroxy-5-methylphenyl) 3-methylsulfonylbenzenesulfonate.
| Compound Name | (3-hydroxy-5-methylphenyl) 3-methylsulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 57307806 |
| Molecular Formula | C14H14O6S2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (3-hydroxy-5-methylphenyl) 3-methylsulfonylbenzenesulfonate |
| SMILES | Cc1cc(O)cc(OS(=O)(=O)c2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C14H14O6S2/c1-10-6-11(15)8-12(7-10)20-22(18,19)14-5-3-4-13(9-14)21(2,16)17/h3-9,15H,1-2H3 |
| InChIKey | OAYYUDOUVNDKAC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|