C20H20N2O6S2 — CID 57322853
(3-hydroxy-5-methylphenyl) 2-[methyl(pyridin-3-ylmethyl)sulfamoyl]benzenesulfonate (PubChem CID 57322853) has the molecular formula C20H20N2O6S2 and a molecular weight of 448.52 g/mol. Its IUPAC name is (3-hydroxy-5-methylphenyl) 2-[methyl(pyridin-3-ylmethyl)sulfamoyl]benzenesulfonate.
| Compound Name | (3-hydroxy-5-methylphenyl) 2-[methyl(pyridin-3-ylmethyl)sulfamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 57322853 |
| Molecular Formula | C20H20N2O6S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (3-hydroxy-5-methylphenyl) 2-[methyl(pyridin-3-ylmethyl)sulfamoyl]benzenesulfonate |
| SMILES | Cc1cc(O)cc(OS(=O)(=O)c2ccccc2S(=O)(=O)N(C)Cc2cccnc2)c1 |
| InChI | InChI=1S/C20H20N2O6S2/c1-15-10-17(23)12-18(11-15)28-30(26,27)20-8-4-3-7-19(20)29(24,25)22(2)14-16-6-5-9-21-13-16/h3-13,23H,14H2,1-2H3 |
| InChIKey | UBGNGJVPPKKMDX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|