C23H23NO8S2 — CID 57246135
3-[benzyl-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylamino]propanoic acid (PubChem CID 57246135) has the molecular formula C23H23NO8S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is 3-[benzyl-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[benzyl-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 57246135 |
| Molecular Formula | C23H23NO8S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 3-[benzyl-[2-(3-hydroxy-5-methylphenoxy)sulfonylphenyl]sulfonylamino]propanoic acid |
| SMILES | Cc1cc(O)cc(OS(=O)(=O)c2ccccc2S(=O)(=O)N(CCC(=O)O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H23NO8S2/c1-17-13-19(25)15-20(14-17)32-34(30,31)22-10-6-5-9-21(22)33(28,29)24(12-11-23(26)27)16-18-7-3-2-4-8-18/h2-10,13-15,25H,11-12,16H2,1H3,(H,26,27) |
| InChIKey | VDEGUIRXFHQZOU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|