C21H16N2O4S — CID 3853066
N-methyl-9,10-dioxo-N-(pyridin-3-ylmethyl)anthracene-1-sulfonamide (PubChem CID 3853066) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-methyl-9,10-dioxo-N-(pyridin-3-ylmethyl)anthracene-1-sulfonamide.
| Compound Name | N-methyl-9,10-dioxo-N-(pyridin-3-ylmethyl)anthracene-1-sulfonamide |
|---|---|
| PubChem CID | 3853066 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-methyl-9,10-dioxo-N-(pyridin-3-ylmethyl)anthracene-1-sulfonamide |
| SMILES | CN(Cc1cccnc1)S(=O)(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H16N2O4S/c1-23(13-14-6-5-11-22-12-14)28(26,27)18-10-4-9-17-19(18)21(25)16-8-3-2-7-15(16)20(17)24/h2-12H,13H2,1H3 |
| InChIKey | WECFARHZMMEJKQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|