C13H13F2N3O2S — CID 43563355
5-amino-2,4-difluoro-N-methyl-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 43563355) has the molecular formula C13H13F2N3O2S and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-methyl-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-methyl-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43563355 |
| Molecular Formula | C13H13F2N3O2S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-amino-2,4-difluoro-N-methyl-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | CN(Cc1cccnc1)S(=O)(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C13H13F2N3O2S/c1-18(8-9-3-2-4-17-7-9)21(19,20)13-6-12(16)10(14)5-11(13)15/h2-7H,8,16H2,1H3 |
| InChIKey | LJWPFDPXRCHGJT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|