C17H20N2O4S2 — CID 25151784
[3-[(Z)-[amino(propylsulfanyl)methylidene]amino]oxy-5-methylphenyl] benzenesulfonate (PubChem CID 25151784) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is [3-[(Z)-[amino(propylsulfanyl)methylidene]amino]oxy-5-methylphenyl] benzenesulfonate.
| Compound Name | [3-[(Z)-[amino(propylsulfanyl)methylidene]amino]oxy-5-methylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 25151784 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [3-[(Z)-[amino(propylsulfanyl)methylidene]amino]oxy-5-methylphenyl] benzenesulfonate |
| SMILES | CCCS/C(N)=N\Oc1cc(C)cc(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-3-9-24-17(18)19-22-14-10-13(2)11-15(12-14)23-25(20,21)16-7-5-4-6-8-16/h4-8,10-12H,3,9H2,1-2H3,(H2,18,19) |
| InChIKey | FPDOOTSPFKPSMJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|