C18H20N4O5S — CID 57320999
[3-[[amino-(propoxyamino)methylidene]amino]oxy-5-methylphenyl] 2-cyanobenzenesulfonate (PubChem CID 57320999) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is [3-[[amino-(propoxyamino)methylidene]amino]oxy-5-methylphenyl] 2-cyanobenzenesulfonate.
| Compound Name | [3-[[amino-(propoxyamino)methylidene]amino]oxy-5-methylphenyl] 2-cyanobenzenesulfonate |
|---|---|
| PubChem CID | 57320999 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [3-[[amino-(propoxyamino)methylidene]amino]oxy-5-methylphenyl] 2-cyanobenzenesulfonate |
| SMILES | CCCONC(N)=NOc1cc(C)cc(OS(=O)(=O)c2ccccc2C#N)c1 |
| InChI | InChI=1S/C18H20N4O5S/c1-3-8-25-21-18(20)22-26-15-9-13(2)10-16(11-15)27-28(23,24)17-7-5-4-6-14(17)12-19/h4-7,9-11H,3,8H2,1-2H3,(H3,20,21,22) |
| InChIKey | OYAPWLUMCZDLMV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|