C14H10Br2O4S — CID 4770111
(2,4-dibromo-6-formylphenyl) 4-methylbenzenesulfonate (PubChem CID 4770111) has the molecular formula C14H10Br2O4S and a molecular weight of 434.11 g/mol. Its IUPAC name is (2,4-dibromo-6-formylphenyl) 4-methylbenzenesulfonate.
| Compound Name | (2,4-dibromo-6-formylphenyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 4770111 |
| Molecular Formula | C14H10Br2O4S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.87 |
| IUPAC Name | (2,4-dibromo-6-formylphenyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Br)cc(Br)cc2C=O)cc1 |
| InChI | InChI=1S/C14H10Br2O4S/c1-9-2-4-12(5-3-9)21(18,19)20-14-10(8-17)6-11(15)7-13(14)16/h2-8H,1H3 |
| InChIKey | ZVVTZTWUWJZCDE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|