C18H15BrO4 — CID 129451508
(E)-3-[4-(2-bromobenzoyl)oxy-3,5-dimethylphenyl]prop-2-enoic acid (PubChem CID 129451508) has the molecular formula C18H15BrO4 and a molecular weight of 375.22 g/mol. Its IUPAC name is (E)-3-[4-(2-bromobenzoyl)oxy-3,5-dimethylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-bromobenzoyl)oxy-3,5-dimethylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 129451508 |
| Molecular Formula | C18H15BrO4 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | (E)-3-[4-(2-bromobenzoyl)oxy-3,5-dimethylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)cc(C)c1OC(=O)c1ccccc1Br |
| InChI | InChI=1S/C18H15BrO4/c1-11-9-13(7-8-16(20)21)10-12(2)17(11)23-18(22)14-5-3-4-6-15(14)19/h3-10H,1-2H3,(H,20,21)/b8-7+ |
| InChIKey | LZAROVDLXOIFGB-BQYQJAHWSA-N |
| XLogP | 4.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|