C22H16F6O2 — CID 102104833
methyl (E)-5-anthracen-9-yl-2,2-bis(trifluoromethyl)pent-4-enoate (PubChem CID 102104833) has the molecular formula C22H16F6O2 and a molecular weight of 426.36 g/mol. Its IUPAC name is methyl (E)-5-anthracen-9-yl-2,2-bis(trifluoromethyl)pent-4-enoate.
| Compound Name | methyl (E)-5-anthracen-9-yl-2,2-bis(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 102104833 |
| Molecular Formula | C22H16F6O2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | methyl (E)-5-anthracen-9-yl-2,2-bis(trifluoromethyl)pent-4-enoate |
| SMILES | COC(=O)C(C/C=C/c1c2ccccc2cc2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H16F6O2/c1-30-19(29)20(21(23,24)25,22(26,27)28)12-6-11-18-16-9-4-2-7-14(16)13-15-8-3-5-10-17(15)18/h2-11,13H,12H2,1H3/b11-6+ |
| InChIKey | MYKOIQNJODXFEC-IZZDOVSWSA-N |
| XLogP | 6.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|