C28H42O4 — CID 10836937
(2E,5R,6E,10E,12R)-1-(2-hydroxy-5-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-5,12-diol (PubChem CID 10836937) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is (2E,5R,6E,10E,12R)-1-(2-hydroxy-5-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-5,12-diol.
| Compound Name | (2E,5R,6E,10E,12R)-1-(2-hydroxy-5-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-5,12-diol |
|---|---|
| PubChem CID | 10836937 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (2E,5R,6E,10E,12R)-1-(2-hydroxy-5-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-5,12-diol |
| SMILES | COc1cc(C)c(O)c(C/C=C(\C)C[C@@H](O)/C=C(\C)CC/C=C(\C)[C@H](O)CC=C(C)C)c1 |
| InChI | InChI=1S/C28H42O4/c1-19(2)11-14-27(30)22(5)10-8-9-20(3)15-25(29)16-21(4)12-13-24-18-26(32-7)17-23(6)28(24)31/h10-12,15,17-18,25,27,29-31H,8-9,13-14,16H2,1-7H3/b20-15+,21-12+,22-10+/t25-,27+/m0/s1 |
| InChIKey | HCFTYFWATNOLFF-UPWWZYRHSA-N |
| XLogP | 6.34 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|