C28H40O9 — CID 23426643
[(10E,14E,15E)-16-acetyloxy-2,14-bis(acetyloxymethylidene)-6,10-dimethyl-4-oxohexadeca-10,15-dienyl] acetate (PubChem CID 23426643) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(10E,14E,15E)-16-acetyloxy-2,14-bis(acetyloxymethylidene)-6,10-dimethyl-4-oxohexadeca-10,15-dienyl] acetate.
| Compound Name | [(10E,14E,15E)-16-acetyloxy-2,14-bis(acetyloxymethylidene)-6,10-dimethyl-4-oxohexadeca-10,15-dienyl] acetate |
|---|---|
| PubChem CID | 23426643 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(10E,14E,15E)-16-acetyloxy-2,14-bis(acetyloxymethylidene)-6,10-dimethyl-4-oxohexadeca-10,15-dienyl] acetate |
| SMILES | CC(=O)OC=C(COC(C)=O)CC(=O)CC(C)CCC/C(C)=C/CCC(/C=C/OC(C)=O)=C\OC(C)=O |
| InChI | InChI=1S/C28H40O9/c1-20(10-8-12-26(17-35-23(4)30)13-14-34-22(3)29)9-7-11-21(2)15-28(33)16-27(18-36-24(5)31)19-37-25(6)32/h10,13-14,17-18,21H,7-9,11-12,15-16,19H2,1-6H3/b14-13+,20-10+,26-17+,27-18? |
| InChIKey | DNBVGRJMDFFMNP-FNABYQCCSA-N |
| XLogP | 5.40 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|