C16H24ClOP — CID 174476907
1-(2-chloro-6-methylphenyl)-3,5,5-trimethyl-2-phosphanylhexan-1-one (PubChem CID 174476907) has the molecular formula C16H24ClOP and a molecular weight of 298.79 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)-3,5,5-trimethyl-2-phosphanylhexan-1-one.
| Compound Name | 1-(2-chloro-6-methylphenyl)-3,5,5-trimethyl-2-phosphanylhexan-1-one |
|---|---|
| PubChem CID | 174476907 |
| Molecular Formula | C16H24ClOP |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)-3,5,5-trimethyl-2-phosphanylhexan-1-one |
| SMILES | Cc1cccc(Cl)c1C(=O)C(P)C(C)CC(C)(C)C |
| InChI | InChI=1S/C16H24ClOP/c1-10-7-6-8-12(17)13(10)14(18)15(19)11(2)9-16(3,4)5/h6-8,11,15H,9,19H2,1-5H3 |
| InChIKey | JHOPMJRUIPQIBX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|