C15H18Cl4LiOP — CID 141023037
lithium (2,3,5,6-tetrachlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanide (PubChem CID 141023037) has the molecular formula C15H18Cl4LiOP and a molecular weight of 394.04 g/mol. Its IUPAC name is lithium (2,3,5,6-tetrachlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanide.
| Compound Name | lithium (2,3,5,6-tetrachlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanide |
|---|---|
| PubChem CID | 141023037 |
| Molecular Formula | C15H18Cl4LiOP |
| Molecular Weight | 394.04 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | lithium (2,3,5,6-tetrachlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanide |
| SMILES | CC(C[P-]C(=O)c1c(Cl)c(Cl)cc(Cl)c1Cl)CC(C)(C)C.[Li+] |
| InChI | InChI=1S/C15H18Cl4OP.Li/c1-8(6-15(2,3)4)7-21-14(20)11-12(18)9(16)5-10(17)13(11)19;/h5,8H,6-7H2,1-4H3;/q-1;+1 |
| InChIKey | BBOUMCYUGGCLKA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.04 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|