C26H35O11P — CID 141389570
[[2,6-bis(methylperoxy)benzoyl]-(2,4,4-trimethylpentyl)phosphoryl]-[2,6-bis(methylperoxy)phenyl]methanone (PubChem CID 141389570) has the molecular formula C26H35O11P and a molecular weight of 554.53 g/mol. Its IUPAC name is [[2,6-bis(methylperoxy)benzoyl]-(2,4,4-trimethylpentyl)phosphoryl]-[2,6-bis(methylperoxy)phenyl]methanone.
| Compound Name | [[2,6-bis(methylperoxy)benzoyl]-(2,4,4-trimethylpentyl)phosphoryl]-[2,6-bis(methylperoxy)phenyl]methanone |
|---|---|
| PubChem CID | 141389570 |
| Molecular Formula | C26H35O11P |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | [[2,6-bis(methylperoxy)benzoyl]-(2,4,4-trimethylpentyl)phosphoryl]-[2,6-bis(methylperoxy)phenyl]methanone |
| SMILES | COOc1cccc(OOC)c1C(=O)P(=O)(CC(C)CC(C)(C)C)C(=O)c1c(OOC)cccc1OOC |
| InChI | InChI=1S/C26H35O11P/c1-17(15-26(2,3)4)16-38(29,24(27)22-18(34-30-5)11-9-12-19(22)35-31-6)25(28)23-20(36-32-7)13-10-14-21(23)37-33-8/h9-14,17H,15-16H2,1-8H3 |
| InChIKey | APEJUTHGKGGPGE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|