C26H35O7P — CID 26967458
[(2,6-dimethoxybenzoyl)-[(2S)-2,4,4-trimethylpentyl]phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 26967458) has the molecular formula C26H35O7P and a molecular weight of 490.53 g/mol. Its IUPAC name is [(2,6-dimethoxybenzoyl)-[(2S)-2,4,4-trimethylpentyl]phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [(2,6-dimethoxybenzoyl)-[(2S)-2,4,4-trimethylpentyl]phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 26967458 |
| Molecular Formula | C26H35O7P |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [(2,6-dimethoxybenzoyl)-[(2S)-2,4,4-trimethylpentyl]phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)P(=O)(C[C@@H](C)CC(C)(C)C)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C26H35O7P/c1-17(15-26(2,3)4)16-34(29,24(27)22-18(30-5)11-9-12-19(22)31-6)25(28)23-20(32-7)13-10-14-21(23)33-8/h9-14,17H,15-16H2,1-8H3/t17-/m0/s1 |
| InChIKey | LFOXEOLGJPJZAA-KRWDZBQOSA-N |
| XLogP | 6.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|