C11H11NO7 — CID 122417734
methyl 8-methoxy-6-nitro-2,3-dihydro-1,4-benzodioxine-5-carboxylate (PubChem CID 122417734) has the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. Its IUPAC name is methyl 8-methoxy-6-nitro-2,3-dihydro-1,4-benzodioxine-5-carboxylate.
| Compound Name | methyl 8-methoxy-6-nitro-2,3-dihydro-1,4-benzodioxine-5-carboxylate |
|---|---|
| PubChem CID | 122417734 |
| Molecular Formula | C11H11NO7 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | methyl 8-methoxy-6-nitro-2,3-dihydro-1,4-benzodioxine-5-carboxylate |
| SMILES | COC(=O)c1c([N+](=O)[O-])cc(OC)c2c1OCCO2 |
| InChI | InChI=1S/C11H11NO7/c1-16-7-5-6(12(14)15)8(11(13)17-2)10-9(7)18-3-4-19-10/h5H,3-4H2,1-2H3 |
| InChIKey | WMAVOCKUGBZAAN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|