About morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate
morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate (PubChem CID 150726508) has the molecular formula C16H22N2O6
and a molecular weight of 338.36 g/mol. Its IUPAC name is morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate.
Molecular Properties
| Compound Name | morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate |
| PubChem CID | 150726508 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate |
| SMILES | COc1cc(C(C)(C)C)cc([N+](=O)[O-])c1C(=O)ON1CCOCC1 |
| InChI | InChI=1S/C16H22N2O6/c1-16(2,3)11-9-12(18(20)21)14(13(10-11)22-4)15(19)24-17-5-7-23-8-6-17/h9-10H,5-8H2,1-4H3 |
| InChIKey | JQXZRQGBWTVHPK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate?
The IUPAC name of morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate (CID 150726508) is morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate.
What is the SMILES notation for morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate?
The canonical SMILES for morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate is COc1cc(C(C)(C)C)cc([N+](=O)[O-])c1C(=O)ON1CCOCC1.
What is the InChIKey of morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate?
The InChIKey is JQXZRQGBWTVHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O6/c1-16(2,3)11-9-12(18(20)21)14(13(10-11)22-4)15(19)24-17-5-7-23-8-6-17/h9-10H,5-8H2,1-4H3.
What are the key properties of morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate?
morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate has a molecular weight of 338.36 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl 4-tert-butyl-2-methoxy-6-nitrobenzoate is sourced from PubChem (CID 150726508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).