C18H19NO6 — CID 9044040
(2,6-dimethylphenyl) 5-ethoxy-4-methoxy-2-nitrobenzoate (PubChem CID 9044040) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 5-ethoxy-4-methoxy-2-nitrobenzoate.
| Compound Name | (2,6-dimethylphenyl) 5-ethoxy-4-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 9044040 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2,6-dimethylphenyl) 5-ethoxy-4-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc(C(=O)Oc2c(C)cccc2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H19NO6/c1-5-24-16-9-13(14(19(21)22)10-15(16)23-4)18(20)25-17-11(2)7-6-8-12(17)3/h6-10H,5H2,1-4H3 |
| InChIKey | BHPAPOHHAYQHAD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|