C13H14N2O6 — CID 9125063
[(1S)-1-cyanoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 9125063) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [(1S)-1-cyanoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 9125063 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [(1S)-1-cyanoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)O[C@@H](C)C#N)cc1OC |
| InChI | InChI=1S/C13H14N2O6/c1-4-20-12-6-10(15(17)18)9(5-11(12)19-3)13(16)21-8(2)7-14/h5-6,8H,4H2,1-3H3/t8-/m0/s1 |
| InChIKey | RSYJDZYNBCHAGL-QMMMGPOBSA-N |
| XLogP | 2.07 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|