C20H21ClN2O7 — CID 46626102
[1-[(4-chlorophenyl)methylamino]-1-oxopropan-2-yl] 5-ethoxy-4-methoxy-2-nitrobenzoate (PubChem CID 46626102) has the molecular formula C20H21ClN2O7 and a molecular weight of 436.85 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methylamino]-1-oxopropan-2-yl] 5-ethoxy-4-methoxy-2-nitrobenzoate.
| Compound Name | [1-[(4-chlorophenyl)methylamino]-1-oxopropan-2-yl] 5-ethoxy-4-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 46626102 |
| Molecular Formula | C20H21ClN2O7 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [1-[(4-chlorophenyl)methylamino]-1-oxopropan-2-yl] 5-ethoxy-4-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc(C(=O)OC(C)C(=O)NCc2ccc(Cl)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H21ClN2O7/c1-4-29-18-9-15(16(23(26)27)10-17(18)28-3)20(25)30-12(2)19(24)22-11-13-5-7-14(21)8-6-13/h5-10,12H,4,11H2,1-3H3,(H,22,24) |
| InChIKey | DNAJXKNWAQHSSA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|