C21H24N2O9 — CID 46683510
methyl 5-[2-(4-ethoxy-5-methoxy-2-nitrobenzoyl)oxypropanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 46683510) has the molecular formula C21H24N2O9 and a molecular weight of 448.43 g/mol. Its IUPAC name is methyl 5-[2-(4-ethoxy-5-methoxy-2-nitrobenzoyl)oxypropanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[2-(4-ethoxy-5-methoxy-2-nitrobenzoyl)oxypropanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 46683510 |
| Molecular Formula | C21H24N2O9 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | methyl 5-[2-(4-ethoxy-5-methoxy-2-nitrobenzoyl)oxypropanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OC(C)C(=O)c2[nH]c(C)c(C(=O)OC)c2C)cc1OC |
| InChI | InChI=1S/C21H24N2O9/c1-7-31-16-9-14(23(27)28)13(8-15(16)29-5)20(25)32-12(4)19(24)18-10(2)17(11(3)22-18)21(26)30-6/h8-9,12,22H,7H2,1-6H3 |
| InChIKey | MIGCMMPEEJDUOJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 147.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|