C9H5IN2O3 — CID 112572224
5-(1,3-benzodioxol-5-yl)-3-iodo-1,2,4-oxadiazole (PubChem CID 112572224) has the molecular formula C9H5IN2O3 and a molecular weight of 316.05 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-iodo-1,2,4-oxadiazole.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-iodo-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112572224 |
| Molecular Formula | C9H5IN2O3 |
| Molecular Weight | 316.05 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-iodo-1,2,4-oxadiazole |
| SMILES | Ic1noc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C9H5IN2O3/c10-9-11-8(15-12-9)5-1-2-6-7(3-5)14-4-13-6/h1-3H,4H2 |
| InChIKey | IYSALBJPJFUKBL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.05 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|