C10H10N2O4 — CID 15210346
2-amino-6,7-dimethoxy-3,1-benzoxazin-4-one (PubChem CID 15210346) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-amino-6,7-dimethoxy-3,1-benzoxazin-4-one.
| Compound Name | 2-amino-6,7-dimethoxy-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 15210346 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-amino-6,7-dimethoxy-3,1-benzoxazin-4-one |
| SMILES | COc1cc2nc(N)oc(=O)c2cc1OC |
| InChI | InChI=1S/C10H10N2O4/c1-14-7-3-5-6(4-8(7)15-2)12-10(11)16-9(5)13/h3-4H,1-2H3,(H2,11,12) |
| InChIKey | LQNUYTMEPOEWDD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |