C13H16N2O4 — CID 72702660
6,7-dimethoxy-2-(propan-2-ylamino)-3,1-benzoxazin-4-one (PubChem CID 72702660) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(propan-2-ylamino)-3,1-benzoxazin-4-one.
| Compound Name | 6,7-dimethoxy-2-(propan-2-ylamino)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 72702660 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 6,7-dimethoxy-2-(propan-2-ylamino)-3,1-benzoxazin-4-one |
| SMILES | COc1cc2nc(NC(C)C)oc(=O)c2cc1OC |
| InChI | InChI=1S/C13H16N2O4/c1-7(2)14-13-15-9-6-11(18-4)10(17-3)5-8(9)12(16)19-13/h5-7H,1-4H3,(H,14,15) |
| InChIKey | YRRJFSINKKPNDM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |