2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid

C12H8BrNO6 — CID 102953853

IUPAC2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid
SMILESCOc1ccc(Br)c(-c2nc(C(=O)O)c(C(=O)O)o2)c1
InChIInChI=1S/C12H8BrNO6/c1-19-5-2-3-7(13)6(4-5)10-14-8(11(15)16)9(20-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18)
InChIKeyOZPVSZQEAUEIKX-UHFFFAOYSA-N
MW342.10 g/mol
LogP2.51
Rot. Bonds4

About 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid

2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 102953853) has the molecular formula C12H8BrNO6 and a molecular weight of 342.10 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid.

Molecular Properties

Compound Name2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid
PubChem CID102953853
Molecular FormulaC12H8BrNO6
Molecular Weight342.10 g/mol
Exact Mass340.95
IUPAC Name2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid
SMILESCOc1ccc(Br)c(-c2nc(C(=O)O)c(C(=O)O)o2)c1
InChIInChI=1S/C12H8BrNO6/c1-19-5-2-3-7(13)6(4-5)10-14-8(11(15)16)9(20-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18)
InChIKeyOZPVSZQEAUEIKX-UHFFFAOYSA-N
XLogP2.51
TPSA109.86 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.10
LogP ≤ 52.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid?
The IUPAC name of 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid (CID 102953853) is 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid.
What is the SMILES notation for 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid?
The canonical SMILES for 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid is COc1ccc(Br)c(-c2nc(C(=O)O)c(C(=O)O)o2)c1.
What is the InChIKey of 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid?
The InChIKey is OZPVSZQEAUEIKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrNO6/c1-19-5-2-3-7(13)6(4-5)10-14-8(11(15)16)9(20-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid?
2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid has a molecular weight of 342.10 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-5-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid is sourced from PubChem (CID 102953853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).