C13H15N3O2 — CID 82478941
3-amino-4-(2,4,5-trimethylphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 82478941) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-amino-4-(2,4,5-trimethylphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-amino-4-(2,4,5-trimethylphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82478941 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-amino-4-(2,4,5-trimethylphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cc(C)c(-c2c(N)n[nH]c2C(=O)O)cc1C |
| InChI | InChI=1S/C13H15N3O2/c1-6-4-8(3)9(5-7(6)2)10-11(13(17)18)15-16-12(10)14/h4-5H,1-3H3,(H,17,18)(H3,14,15,16) |
| InChIKey | RSMBUMJJRYZKSF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |