C8H7N3O2S — CID 82470643
3-amino-4-thiophen-2-yl-1H-pyrazole-5-carboxylic acid (PubChem CID 82470643) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 3-amino-4-thiophen-2-yl-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-amino-4-thiophen-2-yl-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82470643 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 3-amino-4-thiophen-2-yl-1H-pyrazole-5-carboxylic acid |
| SMILES | Nc1n[nH]c(C(=O)O)c1-c1cccs1 |
| InChI | InChI=1S/C8H7N3O2S/c9-7-5(4-2-1-3-14-4)6(8(12)13)10-11-7/h1-3H,(H,12,13)(H3,9,10,11) |
| InChIKey | BBCRHLGIQKWBBF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |